C32H51N5O4 — CID 143597195
[(4aR,6aR,11aS,11bR)-4a-amino-4,4,6a,7,11b-pentamethyl-2,3,5,6,11,11a-hexahydro-1H-benzo[a]fluoren-9-yl] 2-[[2-(2,6-diaminohexanoylamino)acetyl]amino]acetate (PubChem CID 143597195) has the molecular formula C32H51N5O4 and a molecular weight of 569.79 g/mol. Its IUPAC name is [(4aR,6aR,11aS,11bR)-4a-amino-4,4,6a,7,11b-pentamethyl-2,3,5,6,11,11a-hexahydro-1H-benzo[a]fluoren-9-yl] 2-[[2-(2,6-diaminohexanoylamino)acetyl]amino]acetate.
| Compound Name | [(4aR,6aR,11aS,11bR)-4a-amino-4,4,6a,7,11b-pentamethyl-2,3,5,6,11,11a-hexahydro-1H-benzo[a]fluoren-9-yl] 2-[[2-(2,6-diaminohexanoylamino)acetyl]amino]acetate |
|---|---|
| PubChem CID | 143597195 |
| Molecular Formula | C32H51N5O4 |
| Molecular Weight | 569.79 g/mol |
| Exact Mass | 569.39 |
| IUPAC Name | [(4aR,6aR,11aS,11bR)-4a-amino-4,4,6a,7,11b-pentamethyl-2,3,5,6,11,11a-hexahydro-1H-benzo[a]fluoren-9-yl] 2-[[2-(2,6-diaminohexanoylamino)acetyl]amino]acetate |
| SMILES | Cc1cc(OC(=O)CNC(=O)CNC(=O)C(N)CCCCN)cc2c1[C@]1(C)CC[C@@]3(N)C(C)(C)CCC[C@]3(C)[C@H]1C2 |
| InChI | InChI=1S/C32H51N5O4/c1-20-15-22(41-26(39)19-36-25(38)18-37-28(40)23(34)9-6-7-14-33)16-21-17-24-30(4,27(20)21)12-13-32(35)29(2,3)10-8-11-31(24,32)5/h15-16,23-24H,6-14,17-19,33-35H2,1-5H3,(H,36,38)(H,37,40)/t23?,24-,30+,31+,32+/m0/s1 |
| InChIKey | MNNNYDSGBZAHTC-AYBFYLPXSA-N |
| XLogP | 2.73 |
| TPSA | 162.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.79 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|