C26H38O3S — CID 143597213
(4,4,6a,7,11b-pentamethyl-1,2,3,4a,5,6,11,11a-octahydrobenzo[a]fluoren-9-yl) 2-(2-hydroxyethylsulfanyl)acetate (PubChem CID 143597213) has the molecular formula C26H38O3S and a molecular weight of 430.65 g/mol. Its IUPAC name is (4,4,6a,7,11b-pentamethyl-1,2,3,4a,5,6,11,11a-octahydrobenzo[a]fluoren-9-yl) 2-(2-hydroxyethylsulfanyl)acetate.
| Compound Name | (4,4,6a,7,11b-pentamethyl-1,2,3,4a,5,6,11,11a-octahydrobenzo[a]fluoren-9-yl) 2-(2-hydroxyethylsulfanyl)acetate |
|---|---|
| PubChem CID | 143597213 |
| Molecular Formula | C26H38O3S |
| Molecular Weight | 430.65 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | (4,4,6a,7,11b-pentamethyl-1,2,3,4a,5,6,11,11a-octahydrobenzo[a]fluoren-9-yl) 2-(2-hydroxyethylsulfanyl)acetate |
| SMILES | Cc1cc(OC(=O)CSCCO)cc2c1C1(C)CCC3C(C)(C)CCCC3(C)C1C2 |
| InChI | InChI=1S/C26H38O3S/c1-17-13-19(29-22(28)16-30-12-11-27)14-18-15-21-25(4)9-6-8-24(2,3)20(25)7-10-26(21,5)23(17)18/h13-14,20-21,27H,6-12,15-16H2,1-5H3 |
| InChIKey | YQMCPUHAWYUWMZ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.65 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|