C17H16N4S — CID 143597630
N-(1-pyridin-4-ylethyl)-8,9-dihydrothieno[3,2-f]quinazolin-1-amine (PubChem CID 143597630) has the molecular formula C17H16N4S and a molecular weight of 308.41 g/mol. Its IUPAC name is N-(1-pyridin-4-ylethyl)-8,9-dihydrothieno[3,2-f]quinazolin-1-amine.
| Compound Name | N-(1-pyridin-4-ylethyl)-8,9-dihydrothieno[3,2-f]quinazolin-1-amine |
|---|---|
| PubChem CID | 143597630 |
| Molecular Formula | C17H16N4S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | N-(1-pyridin-4-ylethyl)-8,9-dihydrothieno[3,2-f]quinazolin-1-amine |
| SMILES | CC(Nc1ncnc2ccc3c(c12)CCS3)c1ccncc1 |
| InChI | InChI=1S/C17H16N4S/c1-11(12-4-7-18-8-5-12)21-17-16-13-6-9-22-15(13)3-2-14(16)19-10-20-17/h2-5,7-8,10-11H,6,9H2,1H3,(H,19,20,21) |
| InChIKey | NFKNKVSZEIUIOK-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |