C23H21N3S — CID 143597653
N-[(2E)-2-ethenyl-1-phenylpenta-2,4-dienyl]-8,9-dihydrothieno[3,2-f]quinazolin-1-amine (PubChem CID 143597653) has the molecular formula C23H21N3S and a molecular weight of 371.51 g/mol. Its IUPAC name is N-[(2E)-2-ethenyl-1-phenylpenta-2,4-dienyl]-8,9-dihydrothieno[3,2-f]quinazolin-1-amine.
| Compound Name | N-[(2E)-2-ethenyl-1-phenylpenta-2,4-dienyl]-8,9-dihydrothieno[3,2-f]quinazolin-1-amine |
|---|---|
| PubChem CID | 143597653 |
| Molecular Formula | C23H21N3S |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | N-[(2E)-2-ethenyl-1-phenylpenta-2,4-dienyl]-8,9-dihydrothieno[3,2-f]quinazolin-1-amine |
| SMILES | C=C/C=C(\C=C)C(Nc1ncnc2ccc3c(c12)CCS3)c1ccccc1 |
| InChI | InChI=1S/C23H21N3S/c1-3-8-16(4-2)22(17-9-6-5-7-10-17)26-23-21-18-13-14-27-20(18)12-11-19(21)24-15-25-23/h3-12,15,22H,1-2,13-14H2,(H,24,25,26)/b16-8+ |
| InChIKey | RUKJXHQYPSIVHW-LZYBPNLTSA-N |
| XLogP | 5.73 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|