C17H19N3S — CID 143597845
6-(cyclohexylmethyl)-3-thiophen-3-ylimidazo[1,2-b]pyridazine (PubChem CID 143597845) has the molecular formula C17H19N3S and a molecular weight of 297.43 g/mol. Its IUPAC name is 6-(cyclohexylmethyl)-3-thiophen-3-ylimidazo[1,2-b]pyridazine.
| Compound Name | 6-(cyclohexylmethyl)-3-thiophen-3-ylimidazo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 143597845 |
| Molecular Formula | C17H19N3S |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 6-(cyclohexylmethyl)-3-thiophen-3-ylimidazo[1,2-b]pyridazine |
| SMILES | c1cc(-c2cnc3ccc(CC4CCCCC4)nn23)cs1 |
| InChI | InChI=1S/C17H19N3S/c1-2-4-13(5-3-1)10-15-6-7-17-18-11-16(20(17)19-15)14-8-9-21-12-14/h6-9,11-13H,1-5,10H2 |
| InChIKey | URIVDRUZVHQFOQ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |