C50H42N2S — CID 143599001
9-[3-(8,9-dihydro-7H-fluoren-3-yl)-5-[3-ethenyl-2-[(Z)-prop-1-enyl]-5-prop-2-enylindol-1-yl]phenyl]-3-prop-2-enylcarbazole;sulfane (PubChem CID 143599001) has the molecular formula C50H42N2S and a molecular weight of 702.97 g/mol. Its IUPAC name is 9-[3-(8,9-dihydro-7H-fluoren-3-yl)-5-[3-ethenyl-2-[(Z)-prop-1-enyl]-5-prop-2-enylindol-1-yl]phenyl]-3-prop-2-enylcarbazole;sulfane.
| Compound Name | 9-[3-(8,9-dihydro-7H-fluoren-3-yl)-5-[3-ethenyl-2-[(Z)-prop-1-enyl]-5-prop-2-enylindol-1-yl]phenyl]-3-prop-2-enylcarbazole;sulfane |
|---|---|
| PubChem CID | 143599001 |
| Molecular Formula | C50H42N2S |
| Molecular Weight | 702.97 g/mol |
| Exact Mass | 702.31 |
| IUPAC Name | 9-[3-(8,9-dihydro-7H-fluoren-3-yl)-5-[3-ethenyl-2-[(Z)-prop-1-enyl]-5-prop-2-enylindol-1-yl]phenyl]-3-prop-2-enylcarbazole;sulfane |
| SMILES | C=CCc1ccc2c(c1)c1c(n2-c2cc(-c3ccc4c(c3)C3=C(CCC=C3)C4)cc(-n3c(/C=C\C)c(C=C)c4cc(CC=C)ccc43)c2)C=C=C=C1.S |
| InChI | InChI=1S/C50H40N2.H2S/c1-5-13-33-20-24-49-45(26-33)41(8-4)47(15-7-3)51(49)39-29-38(35-22-23-37-28-36-16-9-10-17-42(36)44(37)31-35)30-40(32-39)52-48-19-12-11-18-43(48)46-27-34(14-6-2)21-25-50(46)52;/h5-8,10,15,17-27,29-32H,1-2,4,9,13-14,16,28H2,3H3;1H2/b15-7-; |
| InChIKey | UMTCLAPOMPYZBJ-DFPPEFKWSA-N |
| XLogP | 12.94 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.97 |
| LogP ≤ 5 | 12.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|