About ethane;4-methyl-3-[(E)-6-phenylmethoxyhex-4-enoyl]-1,3-oxazolidin-2-one
ethane;4-methyl-3-[(E)-6-phenylmethoxyhex-4-enoyl]-1,3-oxazolidin-2-one (PubChem CID 143599210) has the molecular formula C19H27NO4
and a molecular weight of 333.43 g/mol. Its IUPAC name is ethane;4-methyl-3-[(E)-6-phenylmethoxyhex-4-enoyl]-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | ethane;4-methyl-3-[(E)-6-phenylmethoxyhex-4-enoyl]-1,3-oxazolidin-2-one |
| PubChem CID | 143599210 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | ethane;4-methyl-3-[(E)-6-phenylmethoxyhex-4-enoyl]-1,3-oxazolidin-2-one |
| SMILES | CC.CC1COC(=O)N1C(=O)CC/C=C/COCc1ccccc1 |
| InChI | InChI=1S/C17H21NO4.C2H6/c1-14-12-22-17(20)18(14)16(19)10-6-3-7-11-21-13-15-8-4-2-5-9-15;1-2/h2-5,7-9,14H,6,10-13H2,1H3;1-2H3/b7-3+; |
| InChIKey | ITNQOVRUXAVRFZ-CDQVLDCRSA-N |
| XLogP | 3.93 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-methyl-3-[(E)-6-phenylmethoxyhex-4-enoyl]-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-methyl-3-[(E)-6-phenylmethoxyhex-4-enoyl]-1,3-oxazolidin-2-one?
The IUPAC name of ethane;4-methyl-3-[(E)-6-phenylmethoxyhex-4-enoyl]-1,3-oxazolidin-2-one (CID 143599210) is ethane;4-methyl-3-[(E)-6-phenylmethoxyhex-4-enoyl]-1,3-oxazolidin-2-one.
What is the SMILES notation for ethane;4-methyl-3-[(E)-6-phenylmethoxyhex-4-enoyl]-1,3-oxazolidin-2-one?
The canonical SMILES for ethane;4-methyl-3-[(E)-6-phenylmethoxyhex-4-enoyl]-1,3-oxazolidin-2-one is CC.CC1COC(=O)N1C(=O)CC/C=C/COCc1ccccc1.
What is the InChIKey of ethane;4-methyl-3-[(E)-6-phenylmethoxyhex-4-enoyl]-1,3-oxazolidin-2-one?
The InChIKey is ITNQOVRUXAVRFZ-CDQVLDCRSA-N. The full InChI is InChI=1S/C17H21NO4.C2H6/c1-14-12-22-17(20)18(14)16(19)10-6-3-7-11-21-13-15-8-4-2-5-9-15;1-2/h2-5,7-9,14H,6,10-13H2,1H3;1-2H3/b7-3+;.
What are the key properties of ethane;4-methyl-3-[(E)-6-phenylmethoxyhex-4-enoyl]-1,3-oxazolidin-2-one?
ethane;4-methyl-3-[(E)-6-phenylmethoxyhex-4-enoyl]-1,3-oxazolidin-2-one has a molecular weight of 333.43 g/mol, XLogP of 3.93, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methyl-3-[(E)-6-phenylmethoxyhex-4-enoyl]-1,3-oxazolidin-2-one is sourced from PubChem (CID 143599210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).