C33H23N3O7 — CID 143599457
2-[6-amino-5-[[(2-formylquinolin-8-yl)amino]methyl]-2-methyl-3-oxoxanthen-9-yl]terephthalic acid (PubChem CID 143599457) has the molecular formula C33H23N3O7 and a molecular weight of 573.56 g/mol. Its IUPAC name is 2-[6-amino-5-[[(2-formylquinolin-8-yl)amino]methyl]-2-methyl-3-oxoxanthen-9-yl]terephthalic acid.
| Compound Name | 2-[6-amino-5-[[(2-formylquinolin-8-yl)amino]methyl]-2-methyl-3-oxoxanthen-9-yl]terephthalic acid |
|---|---|
| PubChem CID | 143599457 |
| Molecular Formula | C33H23N3O7 |
| Molecular Weight | 573.56 g/mol |
| Exact Mass | 573.15 |
| IUPAC Name | 2-[6-amino-5-[[(2-formylquinolin-8-yl)amino]methyl]-2-methyl-3-oxoxanthen-9-yl]terephthalic acid |
| SMILES | Cc1cc2c(-c3cc(C(=O)O)ccc3C(=O)O)c3ccc(N)c(CNc4cccc5ccc(C=O)nc45)c3oc-2cc1=O |
| InChI | InChI=1S/C33H23N3O7/c1-16-11-23-28(13-27(16)38)43-31-21(29(23)22-12-18(32(39)40)6-8-20(22)33(41)42)9-10-25(34)24(31)14-35-26-4-2-3-17-5-7-19(15-37)36-30(17)26/h2-13,15,35H,14,34H2,1H3,(H,39,40)(H,41,42) |
| InChIKey | CTTRFKDBFJIZNG-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 172.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.56 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|