C24H27N3O4 — CID 143599705
19-[[2-ethoxyethyl(methyl)amino]methyl]-14-methoxy-9,19-diazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),2(6),7(11),13(18),14,16-hexaene-8,10-dione (PubChem CID 143599705) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is 19-[[2-ethoxyethyl(methyl)amino]methyl]-14-methoxy-9,19-diazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),2(6),7(11),13(18),14,16-hexaene-8,10-dione.
| Compound Name | 19-[[2-ethoxyethyl(methyl)amino]methyl]-14-methoxy-9,19-diazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),2(6),7(11),13(18),14,16-hexaene-8,10-dione |
|---|---|
| PubChem CID | 143599705 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 19-[[2-ethoxyethyl(methyl)amino]methyl]-14-methoxy-9,19-diazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),2(6),7(11),13(18),14,16-hexaene-8,10-dione |
| SMILES | CCOCCN(C)Cn1c2cccc(OC)c2c2c3c(c4c(c21)CCC4)C(=O)NC3=O |
| InChI | InChI=1S/C24H27N3O4/c1-4-31-12-11-26(2)13-27-16-9-6-10-17(30-3)19(16)20-21-18(23(28)25-24(21)29)14-7-5-8-15(14)22(20)27/h6,9-10H,4-5,7-8,11-13H2,1-3H3,(H,25,28,29) |
| InChIKey | YSYFLOPMUNNKNJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|