C15H31NO — CID 143599828
ethane;(2Z,4Z)-5-ethenyl-N,6-dimethylocta-2,4-dien-4-amine;methanol (PubChem CID 143599828) has the molecular formula C15H31NO and a molecular weight of 241.42 g/mol. Its IUPAC name is ethane;(2Z,4Z)-5-ethenyl-N,6-dimethylocta-2,4-dien-4-amine;methanol.
| Compound Name | ethane;(2Z,4Z)-5-ethenyl-N,6-dimethylocta-2,4-dien-4-amine;methanol |
|---|---|
| PubChem CID | 143599828 |
| Molecular Formula | C15H31NO |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.24 |
| IUPAC Name | ethane;(2Z,4Z)-5-ethenyl-N,6-dimethylocta-2,4-dien-4-amine;methanol |
| SMILES | C=C/C(=C(\C=C/C)NC)C(C)CC.CC.CO |
| InChI | InChI=1S/C12H21N.C2H6.CH4O/c1-6-9-12(13-5)11(8-3)10(4)7-2;2*1-2/h6,8-10,13H,3,7H2,1-2,4-5H3;1-2H3;2H,1H3/b9-6-,12-11-;; |
| InChIKey | RRELGWTXRWKPIW-JKHAOOCNSA-N |
| XLogP | 3.90 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|