About 7-methyl-1-[(6-methyl-2,3-dihydro-1H-inden-4-yl)methyl]naphthalene
7-methyl-1-[(6-methyl-2,3-dihydro-1H-inden-4-yl)methyl]naphthalene (PubChem CID 143600250) has the molecular formula C22H22
and a molecular weight of 286.42 g/mol. Its IUPAC name is 7-methyl-1-[(6-methyl-2,3-dihydro-1H-inden-4-yl)methyl]naphthalene.
Molecular Properties
| Compound Name | 7-methyl-1-[(6-methyl-2,3-dihydro-1H-inden-4-yl)methyl]naphthalene |
| PubChem CID | 143600250 |
| Molecular Formula | C22H22 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 7-methyl-1-[(6-methyl-2,3-dihydro-1H-inden-4-yl)methyl]naphthalene |
| SMILES | Cc1cc2c(c(Cc3cccc4ccc(C)cc34)c1)CCC2 |
| InChI | InChI=1S/C22H22/c1-15-9-10-17-5-3-6-19(22(17)13-15)14-20-12-16(2)11-18-7-4-8-21(18)20/h3,5-6,9-13H,4,7-8,14H2,1-2H3 |
| InChIKey | PCYNTDUIWNQASG-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 7-methyl-1-[(6-methyl-2,3-dihydro-1H-inden-4-yl)methyl]naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-1-[(6-methyl-2,3-dihydro-1H-inden-4-yl)methyl]naphthalene?
The IUPAC name of 7-methyl-1-[(6-methyl-2,3-dihydro-1H-inden-4-yl)methyl]naphthalene (CID 143600250) is 7-methyl-1-[(6-methyl-2,3-dihydro-1H-inden-4-yl)methyl]naphthalene.
What is the SMILES notation for 7-methyl-1-[(6-methyl-2,3-dihydro-1H-inden-4-yl)methyl]naphthalene?
The canonical SMILES for 7-methyl-1-[(6-methyl-2,3-dihydro-1H-inden-4-yl)methyl]naphthalene is Cc1cc2c(c(Cc3cccc4ccc(C)cc34)c1)CCC2.
What is the InChIKey of 7-methyl-1-[(6-methyl-2,3-dihydro-1H-inden-4-yl)methyl]naphthalene?
The InChIKey is PCYNTDUIWNQASG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22/c1-15-9-10-17-5-3-6-19(22(17)13-15)14-20-12-16(2)11-18-7-4-8-21(18)20/h3,5-6,9-13H,4,7-8,14H2,1-2H3.
What are the key properties of 7-methyl-1-[(6-methyl-2,3-dihydro-1H-inden-4-yl)methyl]naphthalene?
7-methyl-1-[(6-methyl-2,3-dihydro-1H-inden-4-yl)methyl]naphthalene has a molecular weight of 286.42 g/mol, XLogP of 5.54, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-1-[(6-methyl-2,3-dihydro-1H-inden-4-yl)methyl]naphthalene is sourced from PubChem (CID 143600250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).