About 2-methyl-N'-[(Z)-prop-1-enyl]prop-2-enimidamide
2-methyl-N'-[(Z)-prop-1-enyl]prop-2-enimidamide (PubChem CID 143600490) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is 2-methyl-N'-[(Z)-prop-1-enyl]prop-2-enimidamide.
Molecular Properties
| Compound Name | 2-methyl-N'-[(Z)-prop-1-enyl]prop-2-enimidamide |
| PubChem CID | 143600490 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 2-methyl-N'-[(Z)-prop-1-enyl]prop-2-enimidamide |
| SMILES | C=C(C)/C(N)=N/C=C\C |
| InChI | InChI=1S/C7H12N2/c1-4-5-9-7(8)6(2)3/h4-5H,2H2,1,3H3,(H2,8,9)/b5-4- |
| InChIKey | WEJNUKTWXUMFMC-PLNGDYQASA-N |
| XLogP | 1.45 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N'-[(Z)-prop-1-enyl]prop-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N'-[(Z)-prop-1-enyl]prop-2-enimidamide?
The IUPAC name of 2-methyl-N'-[(Z)-prop-1-enyl]prop-2-enimidamide (CID 143600490) is 2-methyl-N'-[(Z)-prop-1-enyl]prop-2-enimidamide.
What is the SMILES notation for 2-methyl-N'-[(Z)-prop-1-enyl]prop-2-enimidamide?
The canonical SMILES for 2-methyl-N'-[(Z)-prop-1-enyl]prop-2-enimidamide is C=C(C)/C(N)=N/C=C\C.
What is the InChIKey of 2-methyl-N'-[(Z)-prop-1-enyl]prop-2-enimidamide?
The InChIKey is WEJNUKTWXUMFMC-PLNGDYQASA-N. The full InChI is InChI=1S/C7H12N2/c1-4-5-9-7(8)6(2)3/h4-5H,2H2,1,3H3,(H2,8,9)/b5-4-.
What are the key properties of 2-methyl-N'-[(Z)-prop-1-enyl]prop-2-enimidamide?
2-methyl-N'-[(Z)-prop-1-enyl]prop-2-enimidamide has a molecular weight of 124.19 g/mol, XLogP of 1.45, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N'-[(Z)-prop-1-enyl]prop-2-enimidamide is sourced from PubChem (CID 143600490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).