About 8,9-dimethyl-5,9a-dihydro-4aH-cyclohepta[c]pyridine;ethane
8,9-dimethyl-5,9a-dihydro-4aH-cyclohepta[c]pyridine;ethane (PubChem CID 143601031) has the molecular formula C14H21N
and a molecular weight of 203.33 g/mol. Its IUPAC name is 8,9-dimethyl-5,9a-dihydro-4aH-cyclohepta[c]pyridine;ethane.
Molecular Properties
| Compound Name | 8,9-dimethyl-5,9a-dihydro-4aH-cyclohepta[c]pyridine;ethane |
| PubChem CID | 143601031 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 8,9-dimethyl-5,9a-dihydro-4aH-cyclohepta[c]pyridine;ethane |
| SMILES | CC.CC1=C(C)C2C=NC=CC2CC=C1 |
| InChI | InChI=1S/C12H15N.C2H6/c1-9-4-3-5-11-6-7-13-8-12(11)10(9)2;1-2/h3-4,6-8,11-12H,5H2,1-2H3;1-2H3 |
| InChIKey | JIRSNUDFAQGDQD-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8,9-dimethyl-5,9a-dihydro-4aH-cyclohepta[c]pyridine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,9-dimethyl-5,9a-dihydro-4aH-cyclohepta[c]pyridine;ethane?
The IUPAC name of 8,9-dimethyl-5,9a-dihydro-4aH-cyclohepta[c]pyridine;ethane (CID 143601031) is 8,9-dimethyl-5,9a-dihydro-4aH-cyclohepta[c]pyridine;ethane.
What is the SMILES notation for 8,9-dimethyl-5,9a-dihydro-4aH-cyclohepta[c]pyridine;ethane?
The canonical SMILES for 8,9-dimethyl-5,9a-dihydro-4aH-cyclohepta[c]pyridine;ethane is CC.CC1=C(C)C2C=NC=CC2CC=C1.
What is the InChIKey of 8,9-dimethyl-5,9a-dihydro-4aH-cyclohepta[c]pyridine;ethane?
The InChIKey is JIRSNUDFAQGDQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N.C2H6/c1-9-4-3-5-11-6-7-13-8-12(11)10(9)2;1-2/h3-4,6-8,11-12H,5H2,1-2H3;1-2H3.
What are the key properties of 8,9-dimethyl-5,9a-dihydro-4aH-cyclohepta[c]pyridine;ethane?
8,9-dimethyl-5,9a-dihydro-4aH-cyclohepta[c]pyridine;ethane has a molecular weight of 203.33 g/mol, XLogP of 4.14, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8,9-dimethyl-5,9a-dihydro-4aH-cyclohepta[c]pyridine;ethane is sourced from PubChem (CID 143601031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).