About propane;N-(2,3,6-trimethylcyclohex-2-en-1-yl)ethanimine
propane;N-(2,3,6-trimethylcyclohex-2-en-1-yl)ethanimine (PubChem CID 143601093) has the molecular formula C14H27N
and a molecular weight of 209.38 g/mol. Its IUPAC name is propane;N-(2,3,6-trimethylcyclohex-2-en-1-yl)ethanimine.
Molecular Properties
| Compound Name | propane;N-(2,3,6-trimethylcyclohex-2-en-1-yl)ethanimine |
| PubChem CID | 143601093 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | propane;N-(2,3,6-trimethylcyclohex-2-en-1-yl)ethanimine |
| SMILES | C/C=N/C1C(C)=C(C)CCC1C.CCC |
| InChI | InChI=1S/C11H19N.C3H8/c1-5-12-11-9(3)7-6-8(2)10(11)4;1-3-2/h5,9,11H,6-7H2,1-4H3;3H2,1-2H3/b12-5+; |
| InChIKey | CZFLYTGZNBGCPT-NKPNRJPBSA-N |
| XLogP | 4.63 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze propane;N-(2,3,6-trimethylcyclohex-2-en-1-yl)ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane;N-(2,3,6-trimethylcyclohex-2-en-1-yl)ethanimine?
The IUPAC name of propane;N-(2,3,6-trimethylcyclohex-2-en-1-yl)ethanimine (CID 143601093) is propane;N-(2,3,6-trimethylcyclohex-2-en-1-yl)ethanimine.
What is the SMILES notation for propane;N-(2,3,6-trimethylcyclohex-2-en-1-yl)ethanimine?
The canonical SMILES for propane;N-(2,3,6-trimethylcyclohex-2-en-1-yl)ethanimine is C/C=N/C1C(C)=C(C)CCC1C.CCC.
What is the InChIKey of propane;N-(2,3,6-trimethylcyclohex-2-en-1-yl)ethanimine?
The InChIKey is CZFLYTGZNBGCPT-NKPNRJPBSA-N. The full InChI is InChI=1S/C11H19N.C3H8/c1-5-12-11-9(3)7-6-8(2)10(11)4;1-3-2/h5,9,11H,6-7H2,1-4H3;3H2,1-2H3/b12-5+;.
What are the key properties of propane;N-(2,3,6-trimethylcyclohex-2-en-1-yl)ethanimine?
propane;N-(2,3,6-trimethylcyclohex-2-en-1-yl)ethanimine has a molecular weight of 209.38 g/mol, XLogP of 4.63, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propane;N-(2,3,6-trimethylcyclohex-2-en-1-yl)ethanimine is sourced from PubChem (CID 143601093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).