C14H23N — CID 143601110
ethane;(2-ethenyl-1,4,5-trimethylcyclohexa-2,4-dien-1-yl)methanimine (PubChem CID 143601110) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is ethane;(2-ethenyl-1,4,5-trimethylcyclohexa-2,4-dien-1-yl)methanimine.
| Compound Name | ethane;(2-ethenyl-1,4,5-trimethylcyclohexa-2,4-dien-1-yl)methanimine |
|---|---|
| PubChem CID | 143601110 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | ethane;(2-ethenyl-1,4,5-trimethylcyclohexa-2,4-dien-1-yl)methanimine |
| SMILES | CC.[H]/N=C/C1(C)CC(C)=C(C)C=C1C=C |
| InChI | InChI=1S/C12H17N.C2H6/c1-5-11-6-9(2)10(3)7-12(11,4)8-13;1-2/h5-6,8,13H,1,7H2,2-4H3;1-2H3/b13-8+; |
| InChIKey | BHDCWVUWPYFVIU-FNXZNAJJSA-N |
| XLogP | 4.52 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|