About N-(2-fluoro-5-methylcyclohexa-1,5-dien-1-yl)propanamide
N-(2-fluoro-5-methylcyclohexa-1,5-dien-1-yl)propanamide (PubChem CID 143601144) has the molecular formula C10H14FNO
and a molecular weight of 183.23 g/mol. Its IUPAC name is N-(2-fluoro-5-methylcyclohexa-1,5-dien-1-yl)propanamide.
Molecular Properties
| Compound Name | N-(2-fluoro-5-methylcyclohexa-1,5-dien-1-yl)propanamide |
| PubChem CID | 143601144 |
| Molecular Formula | C10H14FNO |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | N-(2-fluoro-5-methylcyclohexa-1,5-dien-1-yl)propanamide |
| SMILES | CCC(=O)NC1=C(F)CCC(C)=C1 |
| InChI | InChI=1S/C10H14FNO/c1-3-10(13)12-9-6-7(2)4-5-8(9)11/h6H,3-5H2,1-2H3,(H,12,13) |
| InChIKey | VBNZOXYVTRRXSB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(2-fluoro-5-methylcyclohexa-1,5-dien-1-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-fluoro-5-methylcyclohexa-1,5-dien-1-yl)propanamide?
The IUPAC name of N-(2-fluoro-5-methylcyclohexa-1,5-dien-1-yl)propanamide (CID 143601144) is N-(2-fluoro-5-methylcyclohexa-1,5-dien-1-yl)propanamide.
What is the SMILES notation for N-(2-fluoro-5-methylcyclohexa-1,5-dien-1-yl)propanamide?
The canonical SMILES for N-(2-fluoro-5-methylcyclohexa-1,5-dien-1-yl)propanamide is CCC(=O)NC1=C(F)CCC(C)=C1.
What is the InChIKey of N-(2-fluoro-5-methylcyclohexa-1,5-dien-1-yl)propanamide?
The InChIKey is VBNZOXYVTRRXSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14FNO/c1-3-10(13)12-9-6-7(2)4-5-8(9)11/h6H,3-5H2,1-2H3,(H,12,13).
What are the key properties of N-(2-fluoro-5-methylcyclohexa-1,5-dien-1-yl)propanamide?
N-(2-fluoro-5-methylcyclohexa-1,5-dien-1-yl)propanamide has a molecular weight of 183.23 g/mol, XLogP of 2.43, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-fluoro-5-methylcyclohexa-1,5-dien-1-yl)propanamide is sourced from PubChem (CID 143601144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).