About 4-[(5-methylcyclohexa-1,5-diene-1-carbonyl)amino]butanoic acid
4-[(5-methylcyclohexa-1,5-diene-1-carbonyl)amino]butanoic acid (PubChem CID 143601186) has the molecular formula C12H17NO3
and a molecular weight of 223.27 g/mol. Its IUPAC name is 4-[(5-methylcyclohexa-1,5-diene-1-carbonyl)amino]butanoic acid.
Molecular Properties
| Compound Name | 4-[(5-methylcyclohexa-1,5-diene-1-carbonyl)amino]butanoic acid |
| PubChem CID | 143601186 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 4-[(5-methylcyclohexa-1,5-diene-1-carbonyl)amino]butanoic acid |
| SMILES | CC1=CC(C(=O)NCCCC(=O)O)=CCC1 |
| InChI | InChI=1S/C12H17NO3/c1-9-4-2-5-10(8-9)12(16)13-7-3-6-11(14)15/h5,8H,2-4,6-7H2,1H3,(H,13,16)(H,14,15) |
| InChIKey | LPIRZJOUXJMBAF-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[(5-methylcyclohexa-1,5-diene-1-carbonyl)amino]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5-methylcyclohexa-1,5-diene-1-carbonyl)amino]butanoic acid?
The IUPAC name of 4-[(5-methylcyclohexa-1,5-diene-1-carbonyl)amino]butanoic acid (CID 143601186) is 4-[(5-methylcyclohexa-1,5-diene-1-carbonyl)amino]butanoic acid.
What is the SMILES notation for 4-[(5-methylcyclohexa-1,5-diene-1-carbonyl)amino]butanoic acid?
The canonical SMILES for 4-[(5-methylcyclohexa-1,5-diene-1-carbonyl)amino]butanoic acid is CC1=CC(C(=O)NCCCC(=O)O)=CCC1.
What is the InChIKey of 4-[(5-methylcyclohexa-1,5-diene-1-carbonyl)amino]butanoic acid?
The InChIKey is LPIRZJOUXJMBAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO3/c1-9-4-2-5-10(8-9)12(16)13-7-3-6-11(14)15/h5,8H,2-4,6-7H2,1H3,(H,13,16)(H,14,15).
What are the key properties of 4-[(5-methylcyclohexa-1,5-diene-1-carbonyl)amino]butanoic acid?
4-[(5-methylcyclohexa-1,5-diene-1-carbonyl)amino]butanoic acid has a molecular weight of 223.27 g/mol, XLogP of 1.63, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5-methylcyclohexa-1,5-diene-1-carbonyl)amino]butanoic acid is sourced from PubChem (CID 143601186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).