C21H38N2O2 — CID 143601976
3-amino-4-[[(E,2E)-2-but-3-en-2-ylidene-4-methylhex-3-enyl]amino]cyclobut-3-ene-1,2-dione;ethane (PubChem CID 143601976) has the molecular formula C21H38N2O2 and a molecular weight of 350.55 g/mol. Its IUPAC name is 3-amino-4-[[(E,2E)-2-but-3-en-2-ylidene-4-methylhex-3-enyl]amino]cyclobut-3-ene-1,2-dione;ethane.
| Compound Name | 3-amino-4-[[(E,2E)-2-but-3-en-2-ylidene-4-methylhex-3-enyl]amino]cyclobut-3-ene-1,2-dione;ethane |
|---|---|
| PubChem CID | 143601976 |
| Molecular Formula | C21H38N2O2 |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.29 |
| IUPAC Name | 3-amino-4-[[(E,2E)-2-but-3-en-2-ylidene-4-methylhex-3-enyl]amino]cyclobut-3-ene-1,2-dione;ethane |
| SMILES | C=C/C(C)=C(\C=C(/C)CC)CNc1c(N)c(=O)c1=O.CC.CC.CC |
| InChI | InChI=1S/C15H20N2O2.3C2H6/c1-5-9(3)7-11(10(4)6-2)8-17-13-12(16)14(18)15(13)19;3*1-2/h6-7,17H,2,5,8,16H2,1,3-4H3;3*1-2H3/b9-7+,11-10+;;; |
| InChIKey | FZLMYEQSKCQRAS-PFHKJQCJSA-N |
| XLogP | 5.21 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|