C23H21FN2O2 — CID 143602105
5-fluoro-N-[(2R)-2-hydroxy-1,2-diphenylethyl]-4,5-dihydro-1H-indole-2-carboxamide (PubChem CID 143602105) has the molecular formula C23H21FN2O2 and a molecular weight of 376.43 g/mol. Its IUPAC name is 5-fluoro-N-[(2R)-2-hydroxy-1,2-diphenylethyl]-4,5-dihydro-1H-indole-2-carboxamide.
| Compound Name | 5-fluoro-N-[(2R)-2-hydroxy-1,2-diphenylethyl]-4,5-dihydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 143602105 |
| Molecular Formula | C23H21FN2O2 |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 5-fluoro-N-[(2R)-2-hydroxy-1,2-diphenylethyl]-4,5-dihydro-1H-indole-2-carboxamide |
| SMILES | O=C(NC(c1ccccc1)[C@H](O)c1ccccc1)c1cc2c([nH]1)C=CC(F)C2 |
| InChI | InChI=1S/C23H21FN2O2/c24-18-11-12-19-17(13-18)14-20(25-19)23(28)26-21(15-7-3-1-4-8-15)22(27)16-9-5-2-6-10-16/h1-12,14,18,21-22,25,27H,13H2,(H,26,28)/t18?,21?,22-/m1/s1 |
| InChIKey | LJPUCNXFVBRBBS-FQUBMZHMSA-N |
| XLogP | 4.13 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |