C16H29F6NO — CID 143602636
N,N-bis(trifluoromethyl)butan-1-amine;3,3,5,5-tetramethylhexan-2-one (PubChem CID 143602636) has the molecular formula C16H29F6NO and a molecular weight of 365.40 g/mol. Its IUPAC name is N,N-bis(trifluoromethyl)butan-1-amine;3,3,5,5-tetramethylhexan-2-one.
| Compound Name | N,N-bis(trifluoromethyl)butan-1-amine;3,3,5,5-tetramethylhexan-2-one |
|---|---|
| PubChem CID | 143602636 |
| Molecular Formula | C16H29F6NO |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | N,N-bis(trifluoromethyl)butan-1-amine;3,3,5,5-tetramethylhexan-2-one |
| SMILES | CC(=O)C(C)(C)CC(C)(C)C.CCCCN(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H20O.C6H9F6N/c1-8(11)10(5,6)7-9(2,3)4;1-2-3-4-13(5(7,8)9)6(10,11)12/h7H2,1-6H3;2-4H2,1H3 |
| InChIKey | YFUYIGOTAQDFBX-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|