About 6-ethylpyrrolo[3,4-b]pyridine-5,7-dione
6-ethylpyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 14360296) has the molecular formula C9H8N2O2
and a molecular weight of 176.18 g/mol. Its IUPAC name is 6-ethylpyrrolo[3,4-b]pyridine-5,7-dione.
Molecular Properties
| Compound Name | 6-ethylpyrrolo[3,4-b]pyridine-5,7-dione |
| PubChem CID | 14360296 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 6-ethylpyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | CCN1C(=O)c2cccnc2C1=O |
| InChI | InChI=1S/C9H8N2O2/c1-2-11-8(12)6-4-3-5-10-7(6)9(11)13/h3-5H,2H2,1H3 |
| InChIKey | OLEHYSGEKSBCHH-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 6-ethylpyrrolo[3,4-b]pyridine-5,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethylpyrrolo[3,4-b]pyridine-5,7-dione?
The IUPAC name of 6-ethylpyrrolo[3,4-b]pyridine-5,7-dione (CID 14360296) is 6-ethylpyrrolo[3,4-b]pyridine-5,7-dione.
What is the SMILES notation for 6-ethylpyrrolo[3,4-b]pyridine-5,7-dione?
The canonical SMILES for 6-ethylpyrrolo[3,4-b]pyridine-5,7-dione is CCN1C(=O)c2cccnc2C1=O.
What is the InChIKey of 6-ethylpyrrolo[3,4-b]pyridine-5,7-dione?
The InChIKey is OLEHYSGEKSBCHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2/c1-2-11-8(12)6-4-3-5-10-7(6)9(11)13/h3-5H,2H2,1H3.
What are the key properties of 6-ethylpyrrolo[3,4-b]pyridine-5,7-dione?
6-ethylpyrrolo[3,4-b]pyridine-5,7-dione has a molecular weight of 176.18 g/mol, XLogP of 0.70, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethylpyrrolo[3,4-b]pyridine-5,7-dione is sourced from PubChem (CID 14360296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).