About 1,3-dimethylpyrrolidine;(2S)-1,2-dimethylpyrrolidine;ethane;3-ethylpyrrolidine
1,3-dimethylpyrrolidine;(2S)-1,2-dimethylpyrrolidine;ethane;3-ethylpyrrolidine (PubChem CID 143603137) has the molecular formula C20H45N3
and a molecular weight of 327.60 g/mol. Its IUPAC name is 1,3-dimethylpyrrolidine;(2S)-1,2-dimethylpyrrolidine;ethane;3-ethylpyrrolidine.
Molecular Properties
| Compound Name | 1,3-dimethylpyrrolidine;(2S)-1,2-dimethylpyrrolidine;ethane;3-ethylpyrrolidine |
| PubChem CID | 143603137 |
| Molecular Formula | C20H45N3 |
| Molecular Weight | 327.60 g/mol |
| Exact Mass | 327.36 |
| IUPAC Name | 1,3-dimethylpyrrolidine;(2S)-1,2-dimethylpyrrolidine;ethane;3-ethylpyrrolidine |
| SMILES | CC.CC1CCN(C)C1.CCC1CCNC1.C[C@H]1CCCN1C |
| InChI | InChI=1S/3C6H13N.C2H6/c1-6-3-4-7(2)5-6;1-6-4-3-5-7(6)2;1-2-6-3-4-7-5-6;1-2/h2*6H,3-5H2,1-2H3;6-7H,2-5H2,1H3;1-2H3/t;6-;;/m.0../s1 |
| InChIKey | DRAZNDGKBNJLEP-GXYYWVIJSA-N |
| XLogP | 4.09 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.60 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,3-dimethylpyrrolidine;(2S)-1,2-dimethylpyrrolidine;ethane;3-ethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethylpyrrolidine;(2S)-1,2-dimethylpyrrolidine;ethane;3-ethylpyrrolidine?
The IUPAC name of 1,3-dimethylpyrrolidine;(2S)-1,2-dimethylpyrrolidine;ethane;3-ethylpyrrolidine (CID 143603137) is 1,3-dimethylpyrrolidine;(2S)-1,2-dimethylpyrrolidine;ethane;3-ethylpyrrolidine.
What is the SMILES notation for 1,3-dimethylpyrrolidine;(2S)-1,2-dimethylpyrrolidine;ethane;3-ethylpyrrolidine?
The canonical SMILES for 1,3-dimethylpyrrolidine;(2S)-1,2-dimethylpyrrolidine;ethane;3-ethylpyrrolidine is CC.CC1CCN(C)C1.CCC1CCNC1.C[C@H]1CCCN1C.
What is the InChIKey of 1,3-dimethylpyrrolidine;(2S)-1,2-dimethylpyrrolidine;ethane;3-ethylpyrrolidine?
The InChIKey is DRAZNDGKBNJLEP-GXYYWVIJSA-N. The full InChI is InChI=1S/3C6H13N.C2H6/c1-6-3-4-7(2)5-6;1-6-4-3-5-7(6)2;1-2-6-3-4-7-5-6;1-2/h2*6H,3-5H2,1-2H3;6-7H,2-5H2,1H3;1-2H3/t;6-;;/m.0../s1.
What are the key properties of 1,3-dimethylpyrrolidine;(2S)-1,2-dimethylpyrrolidine;ethane;3-ethylpyrrolidine?
1,3-dimethylpyrrolidine;(2S)-1,2-dimethylpyrrolidine;ethane;3-ethylpyrrolidine has a molecular weight of 327.60 g/mol, XLogP of 4.09, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylpyrrolidine;(2S)-1,2-dimethylpyrrolidine;ethane;3-ethylpyrrolidine is sourced from PubChem (CID 143603137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).