About N-methyl-2-(1H-pyrrolo[2,3-b]pyridin-2-yl)butan-1-amine
N-methyl-2-(1H-pyrrolo[2,3-b]pyridin-2-yl)butan-1-amine (PubChem CID 143603147) has the molecular formula C12H17N3
and a molecular weight of 203.29 g/mol. Its IUPAC name is N-methyl-2-(1H-pyrrolo[2,3-b]pyridin-2-yl)butan-1-amine.
Molecular Properties
| Compound Name | N-methyl-2-(1H-pyrrolo[2,3-b]pyridin-2-yl)butan-1-amine |
| PubChem CID | 143603147 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | N-methyl-2-(1H-pyrrolo[2,3-b]pyridin-2-yl)butan-1-amine |
| SMILES | CCC(CNC)c1cc2cccnc2[nH]1 |
| InChI | InChI=1S/C12H17N3/c1-3-9(8-13-2)11-7-10-5-4-6-14-12(10)15-11/h4-7,9,13H,3,8H2,1-2H3,(H,14,15) |
| InChIKey | JWCBFDOGIODZDX-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-methyl-2-(1H-pyrrolo[2,3-b]pyridin-2-yl)butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2-(1H-pyrrolo[2,3-b]pyridin-2-yl)butan-1-amine?
The IUPAC name of N-methyl-2-(1H-pyrrolo[2,3-b]pyridin-2-yl)butan-1-amine (CID 143603147) is N-methyl-2-(1H-pyrrolo[2,3-b]pyridin-2-yl)butan-1-amine.
What is the SMILES notation for N-methyl-2-(1H-pyrrolo[2,3-b]pyridin-2-yl)butan-1-amine?
The canonical SMILES for N-methyl-2-(1H-pyrrolo[2,3-b]pyridin-2-yl)butan-1-amine is CCC(CNC)c1cc2cccnc2[nH]1.
What is the InChIKey of N-methyl-2-(1H-pyrrolo[2,3-b]pyridin-2-yl)butan-1-amine?
The InChIKey is JWCBFDOGIODZDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3/c1-3-9(8-13-2)11-7-10-5-4-6-14-12(10)15-11/h4-7,9,13H,3,8H2,1-2H3,(H,14,15).
What are the key properties of N-methyl-2-(1H-pyrrolo[2,3-b]pyridin-2-yl)butan-1-amine?
N-methyl-2-(1H-pyrrolo[2,3-b]pyridin-2-yl)butan-1-amine has a molecular weight of 203.29 g/mol, XLogP of 2.28, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-(1H-pyrrolo[2,3-b]pyridin-2-yl)butan-1-amine is sourced from PubChem (CID 143603147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).