C17H23N6O2SSi+ — CID 143603365
dimethyl-[1-[2-oxo-2-[4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]ethyl]triazol-4-yl]silanylium (PubChem CID 143603365) has the molecular formula C17H23N6O2SSi+ and a molecular weight of 403.56 g/mol. Its IUPAC name is dimethyl-[1-[2-oxo-2-[4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]ethyl]triazol-4-yl]silanylium.
| Compound Name | dimethyl-[1-[2-oxo-2-[4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]ethyl]triazol-4-yl]silanylium |
|---|---|
| PubChem CID | 143603365 |
| Molecular Formula | C17H23N6O2SSi+ |
| Molecular Weight | 403.56 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | dimethyl-[1-[2-oxo-2-[4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]ethyl]triazol-4-yl]silanylium |
| SMILES | C[SiH2+](C)c1cn(CC(=O)N2CCC(c3nc(-c4cccs4)no3)CC2)nn1 |
| InChI | InChI=1S/C17H23N6O2SSi/c1-27(2)14-10-23(21-19-14)11-15(24)22-7-5-12(6-8-22)17-18-16(20-25-17)13-4-3-9-26-13/h3-4,9-10,12H,5-8,11,27H2,1-2H3/q+1 |
| InChIKey | JRRYVOVPNFJSJR-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 89.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.56 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|