About ethane;1-formylazepane-4-carboxamide;2-methoxypropane
ethane;1-formylazepane-4-carboxamide;2-methoxypropane (PubChem CID 143603391) has the molecular formula C14H30N2O3
and a molecular weight of 274.40 g/mol. Its IUPAC name is ethane;1-formylazepane-4-carboxamide;2-methoxypropane.
Molecular Properties
| Compound Name | ethane;1-formylazepane-4-carboxamide;2-methoxypropane |
| PubChem CID | 143603391 |
| Molecular Formula | C14H30N2O3 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | ethane;1-formylazepane-4-carboxamide;2-methoxypropane |
| SMILES | CC.COC(C)C.NC(=O)C1CCCN(C=O)CC1 |
| InChI | InChI=1S/C8H14N2O2.C4H10O.C2H6/c9-8(12)7-2-1-4-10(6-11)5-3-7;1-4(2)5-3;1-2/h6-7H,1-5H2,(H2,9,12);4H,1-3H3;1-2H3 |
| InChIKey | ZEGDGCHARCULDH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-formylazepane-4-carboxamide;2-methoxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-formylazepane-4-carboxamide;2-methoxypropane?
The IUPAC name of ethane;1-formylazepane-4-carboxamide;2-methoxypropane (CID 143603391) is ethane;1-formylazepane-4-carboxamide;2-methoxypropane.
What is the SMILES notation for ethane;1-formylazepane-4-carboxamide;2-methoxypropane?
The canonical SMILES for ethane;1-formylazepane-4-carboxamide;2-methoxypropane is CC.COC(C)C.NC(=O)C1CCCN(C=O)CC1.
What is the InChIKey of ethane;1-formylazepane-4-carboxamide;2-methoxypropane?
The InChIKey is ZEGDGCHARCULDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O2.C4H10O.C2H6/c9-8(12)7-2-1-4-10(6-11)5-3-7;1-4(2)5-3;1-2/h6-7H,1-5H2,(H2,9,12);4H,1-3H3;1-2H3.
What are the key properties of ethane;1-formylazepane-4-carboxamide;2-methoxypropane?
ethane;1-formylazepane-4-carboxamide;2-methoxypropane has a molecular weight of 274.40 g/mol, XLogP of 1.80, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-formylazepane-4-carboxamide;2-methoxypropane is sourced from PubChem (CID 143603391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).