C17H29NO — CID 143603790
1-hydroxy-2,2,4,6,6-pentamethylpiperidine;toluene (PubChem CID 143603790) has the molecular formula C17H29NO and a molecular weight of 263.43 g/mol. Its IUPAC name is 1-hydroxy-2,2,4,6,6-pentamethylpiperidine;toluene.
| Compound Name | 1-hydroxy-2,2,4,6,6-pentamethylpiperidine;toluene |
|---|---|
| PubChem CID | 143603790 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 1-hydroxy-2,2,4,6,6-pentamethylpiperidine;toluene |
| SMILES | CC1CC(C)(C)N(O)C(C)(C)C1.Cc1ccccc1 |
| InChI | InChI=1S/C10H21NO.C7H8/c1-8-6-9(2,3)11(12)10(4,5)7-8;1-7-5-3-2-4-6-7/h8,12H,6-7H2,1-5H3;2-6H,1H3 |
| InChIKey | PRSGDVPOXAZUTM-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |