About butane;5-[1,4-diethyl-5-[(Z)-prop-2-enylideneamino]pyrazol-3-yl]thiophene-2-carbonitrile
butane;5-[1,4-diethyl-5-[(Z)-prop-2-enylideneamino]pyrazol-3-yl]thiophene-2-carbonitrile (PubChem CID 143605010) has the molecular formula C19H26N4S
and a molecular weight of 342.51 g/mol. Its IUPAC name is butane;5-[1,4-diethyl-5-[(Z)-prop-2-enylideneamino]pyrazol-3-yl]thiophene-2-carbonitrile.
Molecular Properties
| Compound Name | butane;5-[1,4-diethyl-5-[(Z)-prop-2-enylideneamino]pyrazol-3-yl]thiophene-2-carbonitrile |
| PubChem CID | 143605010 |
| Molecular Formula | C19H26N4S |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | butane;5-[1,4-diethyl-5-[(Z)-prop-2-enylideneamino]pyrazol-3-yl]thiophene-2-carbonitrile |
| SMILES | C=C/C=N\c1c(CC)c(-c2ccc(C#N)s2)nn1CC.CCCC |
| InChI | InChI=1S/C15H16N4S.C4H10/c1-4-9-17-15-12(5-2)14(18-19(15)6-3)13-8-7-11(10-16)20-13;1-3-4-2/h4,7-9H,1,5-6H2,2-3H3;3-4H2,1-2H3/b17-9-; |
| InChIKey | YGMIINRSNDZWSE-WPTDRQDKSA-N |
| XLogP | 5.76 |
| TPSA | 53.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze butane;5-[1,4-diethyl-5-[(Z)-prop-2-enylideneamino]pyrazol-3-yl]thiophene-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;5-[1,4-diethyl-5-[(Z)-prop-2-enylideneamino]pyrazol-3-yl]thiophene-2-carbonitrile?
The IUPAC name of butane;5-[1,4-diethyl-5-[(Z)-prop-2-enylideneamino]pyrazol-3-yl]thiophene-2-carbonitrile (CID 143605010) is butane;5-[1,4-diethyl-5-[(Z)-prop-2-enylideneamino]pyrazol-3-yl]thiophene-2-carbonitrile.
What is the SMILES notation for butane;5-[1,4-diethyl-5-[(Z)-prop-2-enylideneamino]pyrazol-3-yl]thiophene-2-carbonitrile?
The canonical SMILES for butane;5-[1,4-diethyl-5-[(Z)-prop-2-enylideneamino]pyrazol-3-yl]thiophene-2-carbonitrile is C=C/C=N\c1c(CC)c(-c2ccc(C#N)s2)nn1CC.CCCC.
What is the InChIKey of butane;5-[1,4-diethyl-5-[(Z)-prop-2-enylideneamino]pyrazol-3-yl]thiophene-2-carbonitrile?
The InChIKey is YGMIINRSNDZWSE-WPTDRQDKSA-N. The full InChI is InChI=1S/C15H16N4S.C4H10/c1-4-9-17-15-12(5-2)14(18-19(15)6-3)13-8-7-11(10-16)20-13;1-3-4-2/h4,7-9H,1,5-6H2,2-3H3;3-4H2,1-2H3/b17-9-;.
What are the key properties of butane;5-[1,4-diethyl-5-[(Z)-prop-2-enylideneamino]pyrazol-3-yl]thiophene-2-carbonitrile?
butane;5-[1,4-diethyl-5-[(Z)-prop-2-enylideneamino]pyrazol-3-yl]thiophene-2-carbonitrile has a molecular weight of 342.51 g/mol, XLogP of 5.76, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butane;5-[1,4-diethyl-5-[(Z)-prop-2-enylideneamino]pyrazol-3-yl]thiophene-2-carbonitrile is sourced from PubChem (CID 143605010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).