C14H22O2S — CID 143605936
ethane;(2E,4Z)-2-[(3Z)-5-hydroxyhexa-1,3,5-trien-2-yl]sulfanylhexa-2,4-dien-1-ol (PubChem CID 143605936) has the molecular formula C14H22O2S and a molecular weight of 254.39 g/mol. Its IUPAC name is ethane;(2E,4Z)-2-[(3Z)-5-hydroxyhexa-1,3,5-trien-2-yl]sulfanylhexa-2,4-dien-1-ol.
| Compound Name | ethane;(2E,4Z)-2-[(3Z)-5-hydroxyhexa-1,3,5-trien-2-yl]sulfanylhexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 143605936 |
| Molecular Formula | C14H22O2S |
| Molecular Weight | 254.39 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | ethane;(2E,4Z)-2-[(3Z)-5-hydroxyhexa-1,3,5-trien-2-yl]sulfanylhexa-2,4-dien-1-ol |
| SMILES | C=C(O)/C=C\C(=C)S/C(=C/C=C\C)CO.CC |
| InChI | InChI=1S/C12H16O2S.C2H6/c1-4-5-6-12(9-13)15-11(3)8-7-10(2)14;1-2/h4-8,13-14H,2-3,9H2,1H3;1-2H3/b5-4-,8-7-,12-6+; |
| InChIKey | DNWBIAYOIBQVHQ-IZNPZHSVSA-N |
| XLogP | 4.34 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|