C15H21ClFNO — CID 143606824
4-(1-aminocyclopropyl)-3-(4-chloro-3-fluorophenyl)butan-2-one;ethane (PubChem CID 143606824) has the molecular formula C15H21ClFNO and a molecular weight of 285.79 g/mol. Its IUPAC name is 4-(1-aminocyclopropyl)-3-(4-chloro-3-fluorophenyl)butan-2-one;ethane.
| Compound Name | 4-(1-aminocyclopropyl)-3-(4-chloro-3-fluorophenyl)butan-2-one;ethane |
|---|---|
| PubChem CID | 143606824 |
| Molecular Formula | C15H21ClFNO |
| Molecular Weight | 285.79 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 4-(1-aminocyclopropyl)-3-(4-chloro-3-fluorophenyl)butan-2-one;ethane |
| SMILES | CC.CC(=O)C(CC1(N)CC1)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C13H15ClFNO.C2H6/c1-8(17)10(7-13(16)4-5-13)9-2-3-11(14)12(15)6-9;1-2/h2-3,6,10H,4-5,7,16H2,1H3;1-2H3 |
| InChIKey | NRHFVBFXDXZGBP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.79 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |