About 2-(4-chloro-2-fluorophenyl)pentan-3-one;N-methylethanamine
2-(4-chloro-2-fluorophenyl)pentan-3-one;N-methylethanamine (PubChem CID 143606922) has the molecular formula C14H21ClFNO
and a molecular weight of 273.78 g/mol. Its IUPAC name is 2-(4-chloro-2-fluorophenyl)pentan-3-one;N-methylethanamine.
Molecular Properties
| Compound Name | 2-(4-chloro-2-fluorophenyl)pentan-3-one;N-methylethanamine |
| PubChem CID | 143606922 |
| Molecular Formula | C14H21ClFNO |
| Molecular Weight | 273.78 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 2-(4-chloro-2-fluorophenyl)pentan-3-one;N-methylethanamine |
| SMILES | CCC(=O)C(C)c1ccc(Cl)cc1F.CCNC |
| InChI | InChI=1S/C11H12ClFO.C3H9N/c1-3-11(14)7(2)9-5-4-8(12)6-10(9)13;1-3-4-2/h4-7H,3H2,1-2H3;4H,3H2,1-2H3 |
| InChIKey | KNIKAVPVMNJFSQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.78 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-chloro-2-fluorophenyl)pentan-3-one;N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chloro-2-fluorophenyl)pentan-3-one;N-methylethanamine?
The IUPAC name of 2-(4-chloro-2-fluorophenyl)pentan-3-one;N-methylethanamine (CID 143606922) is 2-(4-chloro-2-fluorophenyl)pentan-3-one;N-methylethanamine.
What is the SMILES notation for 2-(4-chloro-2-fluorophenyl)pentan-3-one;N-methylethanamine?
The canonical SMILES for 2-(4-chloro-2-fluorophenyl)pentan-3-one;N-methylethanamine is CCC(=O)C(C)c1ccc(Cl)cc1F.CCNC.
What is the InChIKey of 2-(4-chloro-2-fluorophenyl)pentan-3-one;N-methylethanamine?
The InChIKey is KNIKAVPVMNJFSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClFO.C3H9N/c1-3-11(14)7(2)9-5-4-8(12)6-10(9)13;1-3-4-2/h4-7H,3H2,1-2H3;4H,3H2,1-2H3.
What are the key properties of 2-(4-chloro-2-fluorophenyl)pentan-3-one;N-methylethanamine?
2-(4-chloro-2-fluorophenyl)pentan-3-one;N-methylethanamine has a molecular weight of 273.78 g/mol, XLogP of 3.79, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chloro-2-fluorophenyl)pentan-3-one;N-methylethanamine is sourced from PubChem (CID 143606922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).