About 3-(4-bromophenyl)-5-[(3,3,3-trifluoro-2-hydroxypropyl)amino]pentan-2-one;methane
3-(4-bromophenyl)-5-[(3,3,3-trifluoro-2-hydroxypropyl)amino]pentan-2-one;methane (PubChem CID 143607097) has the molecular formula C15H21BrF3NO2
and a molecular weight of 384.24 g/mol. Its IUPAC name is 3-(4-bromophenyl)-5-[(3,3,3-trifluoro-2-hydroxypropyl)amino]pentan-2-one;methane.
Molecular Properties
| Compound Name | 3-(4-bromophenyl)-5-[(3,3,3-trifluoro-2-hydroxypropyl)amino]pentan-2-one;methane |
| PubChem CID | 143607097 |
| Molecular Formula | C15H21BrF3NO2 |
| Molecular Weight | 384.24 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | 3-(4-bromophenyl)-5-[(3,3,3-trifluoro-2-hydroxypropyl)amino]pentan-2-one;methane |
| SMILES | C.CC(=O)C(CCNCC(O)C(F)(F)F)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H17BrF3NO2.CH4/c1-9(20)12(10-2-4-11(15)5-3-10)6-7-19-8-13(21)14(16,17)18;/h2-5,12-13,19,21H,6-8H2,1H3;1H4 |
| InChIKey | GRZPETPVRFXTBJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.24 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-bromophenyl)-5-[(3,3,3-trifluoro-2-hydroxypropyl)amino]pentan-2-one;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-bromophenyl)-5-[(3,3,3-trifluoro-2-hydroxypropyl)amino]pentan-2-one;methane?
The IUPAC name of 3-(4-bromophenyl)-5-[(3,3,3-trifluoro-2-hydroxypropyl)amino]pentan-2-one;methane (CID 143607097) is 3-(4-bromophenyl)-5-[(3,3,3-trifluoro-2-hydroxypropyl)amino]pentan-2-one;methane.
What is the SMILES notation for 3-(4-bromophenyl)-5-[(3,3,3-trifluoro-2-hydroxypropyl)amino]pentan-2-one;methane?
The canonical SMILES for 3-(4-bromophenyl)-5-[(3,3,3-trifluoro-2-hydroxypropyl)amino]pentan-2-one;methane is C.CC(=O)C(CCNCC(O)C(F)(F)F)c1ccc(Br)cc1.
What is the InChIKey of 3-(4-bromophenyl)-5-[(3,3,3-trifluoro-2-hydroxypropyl)amino]pentan-2-one;methane?
The InChIKey is GRZPETPVRFXTBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17BrF3NO2.CH4/c1-9(20)12(10-2-4-11(15)5-3-10)6-7-19-8-13(21)14(16,17)18;/h2-5,12-13,19,21H,6-8H2,1H3;1H4.
What are the key properties of 3-(4-bromophenyl)-5-[(3,3,3-trifluoro-2-hydroxypropyl)amino]pentan-2-one;methane?
3-(4-bromophenyl)-5-[(3,3,3-trifluoro-2-hydroxypropyl)amino]pentan-2-one;methane has a molecular weight of 384.24 g/mol, XLogP of 3.66, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-bromophenyl)-5-[(3,3,3-trifluoro-2-hydroxypropyl)amino]pentan-2-one;methane is sourced from PubChem (CID 143607097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).