C17H24F3NO — CID 143607227
4-(cyclopropylmethylamino)-3-[4-(trifluoromethyl)phenyl]butan-2-one;ethane (PubChem CID 143607227) has the molecular formula C17H24F3NO and a molecular weight of 315.38 g/mol. Its IUPAC name is 4-(cyclopropylmethylamino)-3-[4-(trifluoromethyl)phenyl]butan-2-one;ethane.
| Compound Name | 4-(cyclopropylmethylamino)-3-[4-(trifluoromethyl)phenyl]butan-2-one;ethane |
|---|---|
| PubChem CID | 143607227 |
| Molecular Formula | C17H24F3NO |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 4-(cyclopropylmethylamino)-3-[4-(trifluoromethyl)phenyl]butan-2-one;ethane |
| SMILES | CC.CC(=O)C(CNCC1CC1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H18F3NO.C2H6/c1-10(20)14(9-19-8-11-2-3-11)12-4-6-13(7-5-12)15(16,17)18;1-2/h4-7,11,14,19H,2-3,8-9H2,1H3;1-2H3 |
| InChIKey | NSMNWKOPXFHXPR-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |