About 8-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-2-ethoxy-7-methylquinolin-4-amine
8-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-2-ethoxy-7-methylquinolin-4-amine (PubChem CID 143607618) has the molecular formula C22H23Cl2N3O2
and a molecular weight of 432.35 g/mol. Its IUPAC name is 8-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-2-ethoxy-7-methylquinolin-4-amine.
Molecular Properties
| Compound Name | 8-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-2-ethoxy-7-methylquinolin-4-amine |
| PubChem CID | 143607618 |
| Molecular Formula | C22H23Cl2N3O2 |
| Molecular Weight | 432.35 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 8-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-2-ethoxy-7-methylquinolin-4-amine |
| SMILES | CCOc1cc(Nc2c(Cl)cncc2Cl)c2ccc(C)c(OC3CCCC3)c2n1 |
| InChI | InChI=1S/C22H23Cl2N3O2/c1-3-28-19-10-18(26-21-16(23)11-25-12-17(21)24)15-9-8-13(2)22(20(15)27-19)29-14-6-4-5-7-14/h8-12,14H,3-7H2,1-2H3,(H,25,26,27) |
| InChIKey | CWQUTXAOHIBETN-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.35 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-2-ethoxy-7-methylquinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-2-ethoxy-7-methylquinolin-4-amine?
The IUPAC name of 8-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-2-ethoxy-7-methylquinolin-4-amine (CID 143607618) is 8-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-2-ethoxy-7-methylquinolin-4-amine.
What is the SMILES notation for 8-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-2-ethoxy-7-methylquinolin-4-amine?
The canonical SMILES for 8-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-2-ethoxy-7-methylquinolin-4-amine is CCOc1cc(Nc2c(Cl)cncc2Cl)c2ccc(C)c(OC3CCCC3)c2n1.
What is the InChIKey of 8-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-2-ethoxy-7-methylquinolin-4-amine?
The InChIKey is CWQUTXAOHIBETN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23Cl2N3O2/c1-3-28-19-10-18(26-21-16(23)11-25-12-17(21)24)15-9-8-13(2)22(20(15)27-19)29-14-6-4-5-7-14/h8-12,14H,3-7H2,1-2H3,(H,25,26,27).
What are the key properties of 8-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-2-ethoxy-7-methylquinolin-4-amine?
8-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-2-ethoxy-7-methylquinolin-4-amine has a molecular weight of 432.35 g/mol, XLogP of 6.71, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-2-ethoxy-7-methylquinolin-4-amine is sourced from PubChem (CID 143607618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).