C26H30O8 — CID 14360781
tetraethyl 1,2-diphenylethane-1,1,2,2-tetracarboxylate (PubChem CID 14360781) has the molecular formula C26H30O8 and a molecular weight of 470.52 g/mol. Its IUPAC name is tetraethyl 1,2-diphenylethane-1,1,2,2-tetracarboxylate.
| Compound Name | tetraethyl 1,2-diphenylethane-1,1,2,2-tetracarboxylate |
|---|---|
| PubChem CID | 14360781 |
| Molecular Formula | C26H30O8 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | tetraethyl 1,2-diphenylethane-1,1,2,2-tetracarboxylate |
| SMILES | CCOC(=O)C(C(=O)OCC)(c1ccccc1)C(C(=O)OCC)(C(=O)OCC)c1ccccc1 |
| InChI | InChI=1S/C26H30O8/c1-5-31-21(27)25(22(28)32-6-2,19-15-11-9-12-16-19)26(23(29)33-7-3,24(30)34-8-4)20-17-13-10-14-18-20/h9-18H,5-8H2,1-4H3 |
| InChIKey | JAFOKVDVUVUQBY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|