C26H28N6O2S2 — CID 143608062
(2R)-2-[[2-[4-(methylsulfonimidoyl)anilino]-5-[4-(phenylsulfanylamino)phenyl]pyrimidin-4-yl]amino]propan-1-ol (PubChem CID 143608062) has the molecular formula C26H28N6O2S2 and a molecular weight of 520.68 g/mol. Its IUPAC name is (2R)-2-[[2-[4-(methylsulfonimidoyl)anilino]-5-[4-(phenylsulfanylamino)phenyl]pyrimidin-4-yl]amino]propan-1-ol.
| Compound Name | (2R)-2-[[2-[4-(methylsulfonimidoyl)anilino]-5-[4-(phenylsulfanylamino)phenyl]pyrimidin-4-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 143608062 |
| Molecular Formula | C26H28N6O2S2 |
| Molecular Weight | 520.68 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | (2R)-2-[[2-[4-(methylsulfonimidoyl)anilino]-5-[4-(phenylsulfanylamino)phenyl]pyrimidin-4-yl]amino]propan-1-ol |
| SMILES | [H]N=S(C)(=O)c1ccc(Nc2ncc(-c3ccc(NSc4ccccc4)cc3)c(N[C@H](C)CO)n2)cc1 |
| InChI | InChI=1S/C26H28N6O2S2/c1-18(17-33)29-25-24(19-8-10-21(11-9-19)32-35-22-6-4-3-5-7-22)16-28-26(31-25)30-20-12-14-23(15-13-20)36(2,27)34/h3-16,18,27,32-33H,17H2,1-2H3,(H2,28,29,30,31)/t18-,36?/m1/s1 |
| InChIKey | KDIUSSBHSGPPGN-CUQPBNISSA-N |
| XLogP | 5.83 |
| TPSA | 123.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.68 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|