About 6-ethyl-4,6-dimethylcyclohepta[c][1,2,5]oxadiazole
6-ethyl-4,6-dimethylcyclohepta[c][1,2,5]oxadiazole (PubChem CID 143608597) has the molecular formula C11H14N2O
and a molecular weight of 190.25 g/mol. Its IUPAC name is 6-ethyl-4,6-dimethylcyclohepta[c][1,2,5]oxadiazole.
Molecular Properties
| Compound Name | 6-ethyl-4,6-dimethylcyclohepta[c][1,2,5]oxadiazole |
| PubChem CID | 143608597 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 6-ethyl-4,6-dimethylcyclohepta[c][1,2,5]oxadiazole |
| SMILES | CCC1(C)C=Cc2nonc2C(C)=C1 |
| InChI | InChI=1S/C11H14N2O/c1-4-11(3)6-5-9-10(8(2)7-11)13-14-12-9/h5-7H,4H2,1-3H3 |
| InChIKey | WDTRHJHAEGRCRC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-ethyl-4,6-dimethylcyclohepta[c][1,2,5]oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-4,6-dimethylcyclohepta[c][1,2,5]oxadiazole?
The IUPAC name of 6-ethyl-4,6-dimethylcyclohepta[c][1,2,5]oxadiazole (CID 143608597) is 6-ethyl-4,6-dimethylcyclohepta[c][1,2,5]oxadiazole.
What is the SMILES notation for 6-ethyl-4,6-dimethylcyclohepta[c][1,2,5]oxadiazole?
The canonical SMILES for 6-ethyl-4,6-dimethylcyclohepta[c][1,2,5]oxadiazole is CCC1(C)C=Cc2nonc2C(C)=C1.
What is the InChIKey of 6-ethyl-4,6-dimethylcyclohepta[c][1,2,5]oxadiazole?
The InChIKey is WDTRHJHAEGRCRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O/c1-4-11(3)6-5-9-10(8(2)7-11)13-14-12-9/h5-7H,4H2,1-3H3.
What are the key properties of 6-ethyl-4,6-dimethylcyclohepta[c][1,2,5]oxadiazole?
6-ethyl-4,6-dimethylcyclohepta[c][1,2,5]oxadiazole has a molecular weight of 190.25 g/mol, XLogP of 2.92, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-4,6-dimethylcyclohepta[c][1,2,5]oxadiazole is sourced from PubChem (CID 143608597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).