C30H31ClN4O5 — CID 143608856
benzyl N-(5-chloropentyl)-N-[[4-[(7-methoxyquinazolin-4-yl)amino]-1,3-benzodioxol-5-yl]methyl]carbamate (PubChem CID 143608856) has the molecular formula C30H31ClN4O5 and a molecular weight of 563.05 g/mol. Its IUPAC name is benzyl N-(5-chloropentyl)-N-[[4-[(7-methoxyquinazolin-4-yl)amino]-1,3-benzodioxol-5-yl]methyl]carbamate.
| Compound Name | benzyl N-(5-chloropentyl)-N-[[4-[(7-methoxyquinazolin-4-yl)amino]-1,3-benzodioxol-5-yl]methyl]carbamate |
|---|---|
| PubChem CID | 143608856 |
| Molecular Formula | C30H31ClN4O5 |
| Molecular Weight | 563.05 g/mol |
| Exact Mass | 562.20 |
| IUPAC Name | benzyl N-(5-chloropentyl)-N-[[4-[(7-methoxyquinazolin-4-yl)amino]-1,3-benzodioxol-5-yl]methyl]carbamate |
| SMILES | COc1ccc2c(Nc3c(CN(CCCCCCl)C(=O)OCc4ccccc4)ccc4c3OCO4)ncnc2c1 |
| InChI | InChI=1S/C30H31ClN4O5/c1-37-23-11-12-24-25(16-23)32-19-33-29(24)34-27-22(10-13-26-28(27)40-20-39-26)17-35(15-7-3-6-14-31)30(36)38-18-21-8-4-2-5-9-21/h2,4-5,8-13,16,19H,3,6-7,14-15,17-18,20H2,1H3,(H,32,33,34) |
| InChIKey | DUDIODKDEWYJCT-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 95.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.05 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|