C8H15NO — CID 143608911
(2S)-2-[(2S)-2,5-dihydrofuran-2-yl]-N-methylpropan-1-amine (PubChem CID 143608911) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is (2S)-2-[(2S)-2,5-dihydrofuran-2-yl]-N-methylpropan-1-amine.
| Compound Name | (2S)-2-[(2S)-2,5-dihydrofuran-2-yl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 143608911 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | (2S)-2-[(2S)-2,5-dihydrofuran-2-yl]-N-methylpropan-1-amine |
| SMILES | CNC[C@H](C)[C@@H]1C=CCO1 |
| InChI | InChI=1S/C8H15NO/c1-7(6-9-2)8-4-3-5-10-8/h3-4,7-9H,5-6H2,1-2H3/t7-,8-/m0/s1 |
| InChIKey | HRUAEJVYANXMCR-YUMQZZPRSA-N |
| XLogP | 0.80 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|