About (6-methoxycyclohepta-1,3,5-trien-1-yl)methanamine
(6-methoxycyclohepta-1,3,5-trien-1-yl)methanamine (PubChem CID 143609501) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is (6-methoxycyclohepta-1,3,5-trien-1-yl)methanamine.
Molecular Properties
| Compound Name | (6-methoxycyclohepta-1,3,5-trien-1-yl)methanamine |
| PubChem CID | 143609501 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | (6-methoxycyclohepta-1,3,5-trien-1-yl)methanamine |
| SMILES | COC1=CC=CC=C(CN)C1 |
| InChI | InChI=1S/C9H13NO/c1-11-9-5-3-2-4-8(6-9)7-10/h2-5H,6-7,10H2,1H3 |
| InChIKey | UGGZQPUFTMBOQG-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6-methoxycyclohepta-1,3,5-trien-1-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-methoxycyclohepta-1,3,5-trien-1-yl)methanamine?
The IUPAC name of (6-methoxycyclohepta-1,3,5-trien-1-yl)methanamine (CID 143609501) is (6-methoxycyclohepta-1,3,5-trien-1-yl)methanamine.
What is the SMILES notation for (6-methoxycyclohepta-1,3,5-trien-1-yl)methanamine?
The canonical SMILES for (6-methoxycyclohepta-1,3,5-trien-1-yl)methanamine is COC1=CC=CC=C(CN)C1.
What is the InChIKey of (6-methoxycyclohepta-1,3,5-trien-1-yl)methanamine?
The InChIKey is UGGZQPUFTMBOQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO/c1-11-9-5-3-2-4-8(6-9)7-10/h2-5H,6-7,10H2,1H3.
What are the key properties of (6-methoxycyclohepta-1,3,5-trien-1-yl)methanamine?
(6-methoxycyclohepta-1,3,5-trien-1-yl)methanamine has a molecular weight of 151.21 g/mol, XLogP of 1.36, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6-methoxycyclohepta-1,3,5-trien-1-yl)methanamine is sourced from PubChem (CID 143609501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).