C32H31ClF3N6O4+ — CID 143609696
2-chloro-N-[2-[4-[2-(1-methoxypyrrolidin-1-ium-1-yl)ethoxy]anilino]pyrimidin-5-yl]-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide (PubChem CID 143609696) has the molecular formula C32H31ClF3N6O4+ and a molecular weight of 656.09 g/mol. Its IUPAC name is 2-chloro-N-[2-[4-[2-(1-methoxypyrrolidin-1-ium-1-yl)ethoxy]anilino]pyrimidin-5-yl]-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide.
| Compound Name | 2-chloro-N-[2-[4-[2-(1-methoxypyrrolidin-1-ium-1-yl)ethoxy]anilino]pyrimidin-5-yl]-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 143609696 |
| Molecular Formula | C32H31ClF3N6O4+ |
| Molecular Weight | 656.09 g/mol |
| Exact Mass | 655.20 |
| IUPAC Name | 2-chloro-N-[2-[4-[2-(1-methoxypyrrolidin-1-ium-1-yl)ethoxy]anilino]pyrimidin-5-yl]-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide |
| SMILES | CO[N+]1(CCOc2ccc(Nc3ncc(NC(=O)c4cc(NC(=O)c5cccc(C(F)(F)F)c5)ccc4Cl)cn3)cc2)CCCC1 |
| InChI | InChI=1S/C32H30ClF3N6O4/c1-45-42(13-2-3-14-42)15-16-46-26-10-7-23(8-11-26)41-31-37-19-25(20-38-31)40-30(44)27-18-24(9-12-28(27)33)39-29(43)21-5-4-6-22(17-21)32(34,35)36/h4-12,17-20H,2-3,13-16H2,1H3,(H2-,37,38,39,40,41,43,44)/p+1 |
| InChIKey | HXSMYOVULMOXBB-UHFFFAOYSA-O |
| XLogP | 6.95 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.09 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|