About 5-[(1Z)-buta-1,3-dienyl]-N,4-diethyl-N-methyl-1H-pyrazol-3-amine;ethane
5-[(1Z)-buta-1,3-dienyl]-N,4-diethyl-N-methyl-1H-pyrazol-3-amine;ethane (PubChem CID 143609990) has the molecular formula C16H31N3
and a molecular weight of 265.44 g/mol. Its IUPAC name is 5-[(1Z)-buta-1,3-dienyl]-N,4-diethyl-N-methyl-1H-pyrazol-3-amine;ethane.
Molecular Properties
| Compound Name | 5-[(1Z)-buta-1,3-dienyl]-N,4-diethyl-N-methyl-1H-pyrazol-3-amine;ethane |
| PubChem CID | 143609990 |
| Molecular Formula | C16H31N3 |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.25 |
| IUPAC Name | 5-[(1Z)-buta-1,3-dienyl]-N,4-diethyl-N-methyl-1H-pyrazol-3-amine;ethane |
| SMILES | C=C/C=C\c1[nH]nc(N(C)CC)c1CC.CC.CC |
| InChI | InChI=1S/C12H19N3.2C2H6/c1-5-8-9-11-10(6-2)12(14-13-11)15(4)7-3;2*1-2/h5,8-9H,1,6-7H2,2-4H3,(H,13,14);2*1-2H3/b9-8-;; |
| InChIKey | IJIOJXPFOULROE-ULDSSAIZSA-N |
| XLogP | 4.68 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(1Z)-buta-1,3-dienyl]-N,4-diethyl-N-methyl-1H-pyrazol-3-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1Z)-buta-1,3-dienyl]-N,4-diethyl-N-methyl-1H-pyrazol-3-amine;ethane?
The IUPAC name of 5-[(1Z)-buta-1,3-dienyl]-N,4-diethyl-N-methyl-1H-pyrazol-3-amine;ethane (CID 143609990) is 5-[(1Z)-buta-1,3-dienyl]-N,4-diethyl-N-methyl-1H-pyrazol-3-amine;ethane.
What is the SMILES notation for 5-[(1Z)-buta-1,3-dienyl]-N,4-diethyl-N-methyl-1H-pyrazol-3-amine;ethane?
The canonical SMILES for 5-[(1Z)-buta-1,3-dienyl]-N,4-diethyl-N-methyl-1H-pyrazol-3-amine;ethane is C=C/C=C\c1[nH]nc(N(C)CC)c1CC.CC.CC.
What is the InChIKey of 5-[(1Z)-buta-1,3-dienyl]-N,4-diethyl-N-methyl-1H-pyrazol-3-amine;ethane?
The InChIKey is IJIOJXPFOULROE-ULDSSAIZSA-N. The full InChI is InChI=1S/C12H19N3.2C2H6/c1-5-8-9-11-10(6-2)12(14-13-11)15(4)7-3;2*1-2/h5,8-9H,1,6-7H2,2-4H3,(H,13,14);2*1-2H3/b9-8-;;.
What are the key properties of 5-[(1Z)-buta-1,3-dienyl]-N,4-diethyl-N-methyl-1H-pyrazol-3-amine;ethane?
5-[(1Z)-buta-1,3-dienyl]-N,4-diethyl-N-methyl-1H-pyrazol-3-amine;ethane has a molecular weight of 265.44 g/mol, XLogP of 4.68, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1Z)-buta-1,3-dienyl]-N,4-diethyl-N-methyl-1H-pyrazol-3-amine;ethane is sourced from PubChem (CID 143609990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).