C15H17Cl2F3N4O2S — CID 143610173
3-amino-5-chloropyridine-2-carbohydrazide;4-chloro-5-(trifluoromethyl)cyclohepta-2,4,6-triene-1-thiol;methanol (PubChem CID 143610173) has the molecular formula C15H17Cl2F3N4O2S and a molecular weight of 445.29 g/mol. Its IUPAC name is 3-amino-5-chloropyridine-2-carbohydrazide;4-chloro-5-(trifluoromethyl)cyclohepta-2,4,6-triene-1-thiol;methanol.
| Compound Name | 3-amino-5-chloropyridine-2-carbohydrazide;4-chloro-5-(trifluoromethyl)cyclohepta-2,4,6-triene-1-thiol;methanol |
|---|---|
| PubChem CID | 143610173 |
| Molecular Formula | C15H17Cl2F3N4O2S |
| Molecular Weight | 445.29 g/mol |
| Exact Mass | 444.04 |
| IUPAC Name | 3-amino-5-chloropyridine-2-carbohydrazide;4-chloro-5-(trifluoromethyl)cyclohepta-2,4,6-triene-1-thiol;methanol |
| SMILES | CO.FC(F)(F)C1=C(Cl)C=CC(S)C=C1.NNC(=O)c1ncc(Cl)cc1N |
| InChI | InChI=1S/C8H6ClF3S.C6H7ClN4O.CH4O/c9-7-4-2-5(13)1-3-6(7)8(10,11)12;7-3-1-4(8)5(10-2-3)6(12)11-9;1-2/h1-5,13H;1-2H,8-9H2,(H,11,12);2H,1H3 |
| InChIKey | LKLLYJKLVFURNL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|