About 4-[[[1-(2,4-dimethylpentanoyl)piperidin-4-ylidene]amino]oxymethyl]-1H-pyridin-2-one
4-[[[1-(2,4-dimethylpentanoyl)piperidin-4-ylidene]amino]oxymethyl]-1H-pyridin-2-one (PubChem CID 143610187) has the molecular formula C18H27N3O3
and a molecular weight of 333.43 g/mol. Its IUPAC name is 4-[[[1-(2,4-dimethylpentanoyl)piperidin-4-ylidene]amino]oxymethyl]-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 4-[[[1-(2,4-dimethylpentanoyl)piperidin-4-ylidene]amino]oxymethyl]-1H-pyridin-2-one |
| PubChem CID | 143610187 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | 4-[[[1-(2,4-dimethylpentanoyl)piperidin-4-ylidene]amino]oxymethyl]-1H-pyridin-2-one |
| SMILES | CC(C)CC(C)C(=O)N1CCC(=NOCc2cc[nH]c(=O)c2)CC1 |
| InChI | InChI=1S/C18H27N3O3/c1-13(2)10-14(3)18(23)21-8-5-16(6-9-21)20-24-12-15-4-7-19-17(22)11-15/h4,7,11,13-14H,5-6,8-10,12H2,1-3H3,(H,19,22) |
| InChIKey | YBPCAYQEQVYXKC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[[[1-(2,4-dimethylpentanoyl)piperidin-4-ylidene]amino]oxymethyl]-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[[1-(2,4-dimethylpentanoyl)piperidin-4-ylidene]amino]oxymethyl]-1H-pyridin-2-one?
The IUPAC name of 4-[[[1-(2,4-dimethylpentanoyl)piperidin-4-ylidene]amino]oxymethyl]-1H-pyridin-2-one (CID 143610187) is 4-[[[1-(2,4-dimethylpentanoyl)piperidin-4-ylidene]amino]oxymethyl]-1H-pyridin-2-one.
What is the SMILES notation for 4-[[[1-(2,4-dimethylpentanoyl)piperidin-4-ylidene]amino]oxymethyl]-1H-pyridin-2-one?
The canonical SMILES for 4-[[[1-(2,4-dimethylpentanoyl)piperidin-4-ylidene]amino]oxymethyl]-1H-pyridin-2-one is CC(C)CC(C)C(=O)N1CCC(=NOCc2cc[nH]c(=O)c2)CC1.
What is the InChIKey of 4-[[[1-(2,4-dimethylpentanoyl)piperidin-4-ylidene]amino]oxymethyl]-1H-pyridin-2-one?
The InChIKey is YBPCAYQEQVYXKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27N3O3/c1-13(2)10-14(3)18(23)21-8-5-16(6-9-21)20-24-12-15-4-7-19-17(22)11-15/h4,7,11,13-14H,5-6,8-10,12H2,1-3H3,(H,19,22).
What are the key properties of 4-[[[1-(2,4-dimethylpentanoyl)piperidin-4-ylidene]amino]oxymethyl]-1H-pyridin-2-one?
4-[[[1-(2,4-dimethylpentanoyl)piperidin-4-ylidene]amino]oxymethyl]-1H-pyridin-2-one has a molecular weight of 333.43 g/mol, XLogP of 2.55, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[[1-(2,4-dimethylpentanoyl)piperidin-4-ylidene]amino]oxymethyl]-1H-pyridin-2-one is sourced from PubChem (CID 143610187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).