C26H25F2N3O4S — CID 143610219
3-[4-[(4-fluorocyclohepta-1,3,5-trien-1-yl)-(4-fluorophenyl)methoxy]iminopiperidin-1-yl]sulfonylbenzamide (PubChem CID 143610219) has the molecular formula C26H25F2N3O4S and a molecular weight of 513.57 g/mol. Its IUPAC name is 3-[4-[(4-fluorocyclohepta-1,3,5-trien-1-yl)-(4-fluorophenyl)methoxy]iminopiperidin-1-yl]sulfonylbenzamide.
| Compound Name | 3-[4-[(4-fluorocyclohepta-1,3,5-trien-1-yl)-(4-fluorophenyl)methoxy]iminopiperidin-1-yl]sulfonylbenzamide |
|---|---|
| PubChem CID | 143610219 |
| Molecular Formula | C26H25F2N3O4S |
| Molecular Weight | 513.57 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | 3-[4-[(4-fluorocyclohepta-1,3,5-trien-1-yl)-(4-fluorophenyl)methoxy]iminopiperidin-1-yl]sulfonylbenzamide |
| SMILES | NC(=O)c1cccc(S(=O)(=O)N2CCC(=NOC(C3=CC=C(F)C=CC3)c3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C26H25F2N3O4S/c27-21-5-1-3-18(7-10-21)25(19-8-11-22(28)12-9-19)35-30-23-13-15-31(16-14-23)36(33,34)24-6-2-4-20(17-24)26(29)32/h1-2,4-12,17,25H,3,13-16H2,(H2,29,32) |
| InChIKey | BFVOQSIQCRRMMX-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.57 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|