C34H55N6O4+ — CID 143610945
[2,6-diamino-1-[2-[N-[2-(2,6-diaminohexanoyloxy)ethyl]-4-[(E)-2-[4-(diethylamino)phenyl]ethenyl]anilino]ethoxy]hexylidene]oxidanium (PubChem CID 143610945) has the molecular formula C34H55N6O4+ and a molecular weight of 611.85 g/mol. Its IUPAC name is [2,6-diamino-1-[2-[N-[2-(2,6-diaminohexanoyloxy)ethyl]-4-[(E)-2-[4-(diethylamino)phenyl]ethenyl]anilino]ethoxy]hexylidene]oxidanium.
| Compound Name | [2,6-diamino-1-[2-[N-[2-(2,6-diaminohexanoyloxy)ethyl]-4-[(E)-2-[4-(diethylamino)phenyl]ethenyl]anilino]ethoxy]hexylidene]oxidanium |
|---|---|
| PubChem CID | 143610945 |
| Molecular Formula | C34H55N6O4+ |
| Molecular Weight | 611.85 g/mol |
| Exact Mass | 611.43 |
| IUPAC Name | [2,6-diamino-1-[2-[N-[2-(2,6-diaminohexanoyloxy)ethyl]-4-[(E)-2-[4-(diethylamino)phenyl]ethenyl]anilino]ethoxy]hexylidene]oxidanium |
| SMILES | [H]/[O+]=C(/OCCN(CCOC(=O)C(N)CCCCN)c1ccc(/C=C/c2ccc(N(CC)CC)cc2)cc1)C(N)CCCCN |
| InChI | InChI=1S/C34H54N6O4/c1-3-39(4-2)29-17-13-27(14-18-29)11-12-28-15-19-30(20-16-28)40(23-25-43-33(41)31(37)9-5-7-21-35)24-26-44-34(42)32(38)10-6-8-22-36/h11-20,31-32H,3-10,21-26,35-38H2,1-2H3/p+1/b12-11+ |
| InChIKey | IAKBFKLNPUXPBO-VAWYXSNFSA-O |
| XLogP | 3.48 |
| TPSA | 167.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.85 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|