C15H24F3N — CID 143610971
ethane;1-[(3Z,5E)-3-methyl-5-(trifluoromethyl)hepta-1,3,5-trien-2-yl]pyrrolidine (PubChem CID 143610971) has the molecular formula C15H24F3N and a molecular weight of 275.36 g/mol. Its IUPAC name is ethane;1-[(3Z,5E)-3-methyl-5-(trifluoromethyl)hepta-1,3,5-trien-2-yl]pyrrolidine.
| Compound Name | ethane;1-[(3Z,5E)-3-methyl-5-(trifluoromethyl)hepta-1,3,5-trien-2-yl]pyrrolidine |
|---|---|
| PubChem CID | 143610971 |
| Molecular Formula | C15H24F3N |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | ethane;1-[(3Z,5E)-3-methyl-5-(trifluoromethyl)hepta-1,3,5-trien-2-yl]pyrrolidine |
| SMILES | C=C(/C(C)=C\C(=C/C)C(F)(F)F)N1CCCC1.CC |
| InChI | InChI=1S/C13H18F3N.C2H6/c1-4-12(13(14,15)16)9-10(2)11(3)17-7-5-6-8-17;1-2/h4,9H,3,5-8H2,1-2H3;1-2H3/b10-9-,12-4+; |
| InChIKey | NFVBAAZLXLRRTH-YJCBWTGLSA-N |
| XLogP | 5.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|