About 2,2-dimethylpropanal;1-methyl-2-prop-1-en-2-ylpyrrolidine
2,2-dimethylpropanal;1-methyl-2-prop-1-en-2-ylpyrrolidine (PubChem CID 143611047) has the molecular formula C13H25NO
and a molecular weight of 211.35 g/mol. Its IUPAC name is 2,2-dimethylpropanal;1-methyl-2-prop-1-en-2-ylpyrrolidine.
Molecular Properties
| Compound Name | 2,2-dimethylpropanal;1-methyl-2-prop-1-en-2-ylpyrrolidine |
| PubChem CID | 143611047 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | 2,2-dimethylpropanal;1-methyl-2-prop-1-en-2-ylpyrrolidine |
| SMILES | C=C(C)C1CCCN1C.CC(C)(C)C=O |
| InChI | InChI=1S/C8H15N.C5H10O/c1-7(2)8-5-4-6-9(8)3;1-5(2,3)4-6/h8H,1,4-6H2,2-3H3;4H,1-3H3 |
| InChIKey | ZLUMOEFOHPIQEW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethylpropanal;1-methyl-2-prop-1-en-2-ylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylpropanal;1-methyl-2-prop-1-en-2-ylpyrrolidine?
The IUPAC name of 2,2-dimethylpropanal;1-methyl-2-prop-1-en-2-ylpyrrolidine (CID 143611047) is 2,2-dimethylpropanal;1-methyl-2-prop-1-en-2-ylpyrrolidine.
What is the SMILES notation for 2,2-dimethylpropanal;1-methyl-2-prop-1-en-2-ylpyrrolidine?
The canonical SMILES for 2,2-dimethylpropanal;1-methyl-2-prop-1-en-2-ylpyrrolidine is C=C(C)C1CCCN1C.CC(C)(C)C=O.
What is the InChIKey of 2,2-dimethylpropanal;1-methyl-2-prop-1-en-2-ylpyrrolidine?
The InChIKey is ZLUMOEFOHPIQEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N.C5H10O/c1-7(2)8-5-4-6-9(8)3;1-5(2,3)4-6/h8H,1,4-6H2,2-3H3;4H,1-3H3.
What are the key properties of 2,2-dimethylpropanal;1-methyl-2-prop-1-en-2-ylpyrrolidine?
2,2-dimethylpropanal;1-methyl-2-prop-1-en-2-ylpyrrolidine has a molecular weight of 211.35 g/mol, XLogP of 2.89, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpropanal;1-methyl-2-prop-1-en-2-ylpyrrolidine is sourced from PubChem (CID 143611047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).