C26H36ClNO3S — CID 143611530
methyl 2-[3-[(1S)-3-chloro-2-[2-[3-(1-hydroxypentyl)phenyl]ethyl]cyclopentyl]propyl]-1,3-thiazole-5-carboxylate (PubChem CID 143611530) has the molecular formula C26H36ClNO3S and a molecular weight of 478.10 g/mol. Its IUPAC name is methyl 2-[3-[(1S)-3-chloro-2-[2-[3-(1-hydroxypentyl)phenyl]ethyl]cyclopentyl]propyl]-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-[3-[(1S)-3-chloro-2-[2-[3-(1-hydroxypentyl)phenyl]ethyl]cyclopentyl]propyl]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 143611530 |
| Molecular Formula | C26H36ClNO3S |
| Molecular Weight | 478.10 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | methyl 2-[3-[(1S)-3-chloro-2-[2-[3-(1-hydroxypentyl)phenyl]ethyl]cyclopentyl]propyl]-1,3-thiazole-5-carboxylate |
| SMILES | CCCCC(O)c1cccc(CCC2C(Cl)CC[C@@H]2CCCc2ncc(C(=O)OC)s2)c1 |
| InChI | InChI=1S/C26H36ClNO3S/c1-3-4-10-23(29)20-9-5-7-18(16-20)12-14-21-19(13-15-22(21)27)8-6-11-25-28-17-24(32-25)26(30)31-2/h5,7,9,16-17,19,21-23,29H,3-4,6,8,10-15H2,1-2H3/t19-,21?,22?,23?/m0/s1 |
| InChIKey | WXZCHBNNNAHPKY-GHNTVSCVSA-N |
| XLogP | 6.74 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.10 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|