C33H32N2O2S — CID 143611877
6-cyclohexyl-5-[2-(3-methylphenyl)quinolin-6-yl]-4-(2-methylprop-2-enyl)thieno[3,2-b]pyrrole-2-carboxylic acid (PubChem CID 143611877) has the molecular formula C33H32N2O2S and a molecular weight of 520.70 g/mol. Its IUPAC name is 6-cyclohexyl-5-[2-(3-methylphenyl)quinolin-6-yl]-4-(2-methylprop-2-enyl)thieno[3,2-b]pyrrole-2-carboxylic acid.
| Compound Name | 6-cyclohexyl-5-[2-(3-methylphenyl)quinolin-6-yl]-4-(2-methylprop-2-enyl)thieno[3,2-b]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 143611877 |
| Molecular Formula | C33H32N2O2S |
| Molecular Weight | 520.70 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | 6-cyclohexyl-5-[2-(3-methylphenyl)quinolin-6-yl]-4-(2-methylprop-2-enyl)thieno[3,2-b]pyrrole-2-carboxylic acid |
| SMILES | C=C(C)Cn1c(-c2ccc3nc(-c4cccc(C)c4)ccc3c2)c(C2CCCCC2)c2sc(C(=O)O)cc21 |
| InChI | InChI=1S/C33H32N2O2S/c1-20(2)19-35-28-18-29(33(36)37)38-32(28)30(22-9-5-4-6-10-22)31(35)25-13-15-27-24(17-25)12-14-26(34-27)23-11-7-8-21(3)16-23/h7-8,11-18,22H,1,4-6,9-10,19H2,2-3H3,(H,36,37) |
| InChIKey | FGBVAHGCVZHUAZ-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.70 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|