C21H22FN5O — CID 143612057
1-[4-[2-amino-7-(4-fluorophenyl)-5H-cyclohepta[d]pyrimidin-4-yl]piperazin-1-yl]ethanone (PubChem CID 143612057) has the molecular formula C21H22FN5O and a molecular weight of 379.44 g/mol. Its IUPAC name is 1-[4-[2-amino-7-(4-fluorophenyl)-5H-cyclohepta[d]pyrimidin-4-yl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[2-amino-7-(4-fluorophenyl)-5H-cyclohepta[d]pyrimidin-4-yl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 143612057 |
| Molecular Formula | C21H22FN5O |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 1-[4-[2-amino-7-(4-fluorophenyl)-5H-cyclohepta[d]pyrimidin-4-yl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2nc(N)nc3c2CC=C(c2ccc(F)cc2)C=C3)CC1 |
| InChI | InChI=1S/C21H22FN5O/c1-14(28)26-10-12-27(13-11-26)20-18-8-4-16(15-2-6-17(22)7-3-15)5-9-19(18)24-21(23)25-20/h2-7,9H,8,10-13H2,1H3,(H2,23,24,25) |
| InChIKey | MHXSXKIOUYTCQV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |